C17H22O3S — CID 100924685
ethyl 2-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohex-2-en-1-yl]acetate (PubChem CID 100924685) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is ethyl 2-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohex-2-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 100924685 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | ethyl 2-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohex-2-en-1-yl]acetate |
| SMILES | CCOC(=O)C[C@]1(O)CCCC=C1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O3S/c1-3-20-16(18)12-17(19)11-5-4-6-15(17)21-14-9-7-13(2)8-10-14/h6-10,19H,3-5,11-12H2,1-2H3/t17-/m1/s1 |
| InChIKey | BULFYUYFARSAOC-QGZVFWFLSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |