About (1-fluoro-2-oxopropyl) dimethyl phosphite
(1-fluoro-2-oxopropyl) dimethyl phosphite (PubChem CID 100924706) has the molecular formula C5H10FO4P
and a molecular weight of 184.10 g/mol. Its IUPAC name is (1-fluoro-2-oxopropyl) dimethyl phosphite.
Molecular Properties
| Compound Name | (1-fluoro-2-oxopropyl) dimethyl phosphite |
| PubChem CID | 100924706 |
| Molecular Formula | C5H10FO4P |
| Molecular Weight | 184.10 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (1-fluoro-2-oxopropyl) dimethyl phosphite |
| SMILES | COP(OC)OC(F)C(C)=O |
| InChI | InChI=1S/C5H10FO4P/c1-4(7)5(6)10-11(8-2)9-3/h5H,1-3H3 |
| InChIKey | CUVBPWCNPFYZJY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.10 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-fluoro-2-oxopropyl) dimethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-fluoro-2-oxopropyl) dimethyl phosphite?
The IUPAC name of (1-fluoro-2-oxopropyl) dimethyl phosphite (CID 100924706) is (1-fluoro-2-oxopropyl) dimethyl phosphite.
What is the SMILES notation for (1-fluoro-2-oxopropyl) dimethyl phosphite?
The canonical SMILES for (1-fluoro-2-oxopropyl) dimethyl phosphite is COP(OC)OC(F)C(C)=O.
What is the InChIKey of (1-fluoro-2-oxopropyl) dimethyl phosphite?
The InChIKey is CUVBPWCNPFYZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FO4P/c1-4(7)5(6)10-11(8-2)9-3/h5H,1-3H3.
What are the key properties of (1-fluoro-2-oxopropyl) dimethyl phosphite?
(1-fluoro-2-oxopropyl) dimethyl phosphite has a molecular weight of 184.10 g/mol, XLogP of 1.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluoro-2-oxopropyl) dimethyl phosphite is sourced from PubChem (CID 100924706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).