About 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate
1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate (PubChem CID 100924938) has the molecular formula C21H34NO4+
and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate.
Molecular Properties
| Compound Name | 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate |
| PubChem CID | 100924938 |
| Molecular Formula | C21H34NO4+ |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate |
| SMILES | CCCCCCCCCCOC(=O)CCC(=O)OCC[n+]1ccccc1 |
| InChI | InChI=1S/C21H34NO4/c1-2-3-4-5-6-7-8-12-18-25-20(23)13-14-21(24)26-19-17-22-15-10-9-11-16-22/h9-11,15-16H,2-8,12-14,17-19H2,1H3/q+1 |
| InChIKey | NJSZRMFSFVJZHT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate?
The IUPAC name of 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate (CID 100924938) is 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate.
What is the SMILES notation for 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate?
The canonical SMILES for 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate is CCCCCCCCCCOC(=O)CCC(=O)OCC[n+]1ccccc1.
What is the InChIKey of 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate?
The InChIKey is NJSZRMFSFVJZHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34NO4/c1-2-3-4-5-6-7-8-12-18-25-20(23)13-14-21(24)26-19-17-22-15-10-9-11-16-22/h9-11,15-16H,2-8,12-14,17-19H2,1H3/q+1.
What are the key properties of 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate?
1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate has a molecular weight of 364.51 g/mol, XLogP of 3.98, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-decyl 4-O-(2-pyridin-1-ium-1-ylethyl) butanedioate is sourced from PubChem (CID 100924938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).