C20H21NO3 — CID 100925390
(1S,2R,4S,5S,6R)-3-benzyl-5-phenylmethoxy-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonane (PubChem CID 100925390) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (1S,2R,4S,5S,6R)-3-benzyl-5-phenylmethoxy-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonane.
| Compound Name | (1S,2R,4S,5S,6R)-3-benzyl-5-phenylmethoxy-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonane |
|---|---|
| PubChem CID | 100925390 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (1S,2R,4S,5S,6R)-3-benzyl-5-phenylmethoxy-7,9-dioxa-3-azatricyclo[4.2.1.02,4]nonane |
| SMILES | c1ccc(CO[C@@H]2[C@@H]3OC[C@@H](O3)[C@H]3[C@@H]2N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-3-7-14(8-4-1)11-21-17-16-13-23-20(24-16)19(18(17)21)22-12-15-9-5-2-6-10-15/h1-10,16-20H,11-13H2/t16-,17+,18+,19+,20-,21?/m1/s1 |
| InChIKey | VZMMPDNXTMBUMN-UPRTWMTOSA-N |
| XLogP | 2.58 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|