C6H8LiNO2 — CID 100925685
lithium 2,3,4,5-tetrahydropyridine-6-carboxylate (PubChem CID 100925685) has the molecular formula C6H8LiNO2 and a molecular weight of 133.08 g/mol. Its IUPAC name is lithium 2,3,4,5-tetrahydropyridine-6-carboxylate.
| Compound Name | lithium 2,3,4,5-tetrahydropyridine-6-carboxylate |
|---|---|
| PubChem CID | 100925685 |
| Molecular Formula | C6H8LiNO2 |
| Molecular Weight | 133.08 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | lithium 2,3,4,5-tetrahydropyridine-6-carboxylate |
| SMILES | O=C([O-])C1=NCCCC1.[Li+] |
| InChI | InChI=1S/C6H9NO2.Li/c8-6(9)5-3-1-2-4-7-5;/h1-4H2,(H,8,9);/q;+1/p-1 |
| InChIKey | BFQACCSTSZJAGA-UHFFFAOYSA-M |
| XLogP | -3.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.08 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |