C26H27F4N5S — CID 100925771
4-[[4-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline (PubChem CID 100925771) has the molecular formula C26H27F4N5S and a molecular weight of 517.60 g/mol. Its IUPAC name is 4-[[4-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 100925771 |
| Molecular Formula | C26H27F4N5S |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 4-[[4-[(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)diazenyl]phenyl]diazenyl]-N,N-diethylaniline |
| SMILES | CCCCSc1c(F)c(F)c(/N=N/c2ccc(/N=N/c3ccc(N(CC)CC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H27F4N5S/c1-4-7-16-36-26-23(29)21(27)25(22(28)24(26)30)34-33-18-10-8-17(9-11-18)31-32-19-12-14-20(15-13-19)35(5-2)6-3/h8-15H,4-7,16H2,1-3H3/b32-31+,34-33+ |
| InChIKey | IJMVXTNKOCCMPK-HSBKYFPUSA-N |
| XLogP | 9.81 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|