C12H14N4O5S — CID 100925838
(1S,5R)-2-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 100925838) has the molecular formula C12H14N4O5S and a molecular weight of 326.33 g/mol. Its IUPAC name is (1S,5R)-2-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-2-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 100925838 |
| Molecular Formula | C12H14N4O5S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (1S,5R)-2-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | Cn1cnc(/C=C/C(=O)N2CC[C@@H]3[C@H]2C(=O)N3S(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H14N4O5S/c1-14-6-8(13-7-14)2-3-10(17)15-5-4-9-11(15)12(18)16(9)22(19,20)21/h2-3,6-7,9,11H,4-5H2,1H3,(H,19,20,21)/b3-2+/t9-,11+/m1/s1 |
| InChIKey | ZNACHTMIDYBMJY-GZWSGWKISA-N |
| XLogP | -0.95 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|