C19H23NO6 — CID 100926121
(1R,2S,4R,7R,9R,10R,13R)-13-methyl-4-phenyl-9-prop-2-enoxy-3,5,8,14-tetraoxa-11-azatricyclo[8.4.0.02,7]tetradecan-12-one (PubChem CID 100926121) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (1R,2S,4R,7R,9R,10R,13R)-13-methyl-4-phenyl-9-prop-2-enoxy-3,5,8,14-tetraoxa-11-azatricyclo[8.4.0.02,7]tetradecan-12-one.
| Compound Name | (1R,2S,4R,7R,9R,10R,13R)-13-methyl-4-phenyl-9-prop-2-enoxy-3,5,8,14-tetraoxa-11-azatricyclo[8.4.0.02,7]tetradecan-12-one |
|---|---|
| PubChem CID | 100926121 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (1R,2S,4R,7R,9R,10R,13R)-13-methyl-4-phenyl-9-prop-2-enoxy-3,5,8,14-tetraoxa-11-azatricyclo[8.4.0.02,7]tetradecan-12-one |
| SMILES | C=CCO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2O[C@H](C)C(=O)N[C@@H]12 |
| InChI | InChI=1S/C19H23NO6/c1-3-9-22-19-14-16(24-11(2)17(21)20-14)15-13(25-19)10-23-18(26-15)12-7-5-4-6-8-12/h3-8,11,13-16,18-19H,1,9-10H2,2H3,(H,20,21)/t11-,13-,14-,15-,16-,18-,19-/m1/s1 |
| InChIKey | OLIJPYYGHACVCL-VAXZGLNWSA-N |
| XLogP | 1.30 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|