About 2-quinolin-4-ylpropyl acetate
2-quinolin-4-ylpropyl acetate (PubChem CID 100926213) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-quinolin-4-ylpropyl acetate.
Molecular Properties
| Compound Name | 2-quinolin-4-ylpropyl acetate |
| PubChem CID | 100926213 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-quinolin-4-ylpropyl acetate |
| SMILES | CC(=O)OCC(C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C14H15NO2/c1-10(9-17-11(2)16)12-7-8-15-14-6-4-3-5-13(12)14/h3-8,10H,9H2,1-2H3 |
| InChIKey | OGADDSYXWPNYLG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-quinolin-4-ylpropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-4-ylpropyl acetate?
The IUPAC name of 2-quinolin-4-ylpropyl acetate (CID 100926213) is 2-quinolin-4-ylpropyl acetate.
What is the SMILES notation for 2-quinolin-4-ylpropyl acetate?
The canonical SMILES for 2-quinolin-4-ylpropyl acetate is CC(=O)OCC(C)c1ccnc2ccccc12.
What is the InChIKey of 2-quinolin-4-ylpropyl acetate?
The InChIKey is OGADDSYXWPNYLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-10(9-17-11(2)16)12-7-8-15-14-6-4-3-5-13(12)14/h3-8,10H,9H2,1-2H3.
What are the key properties of 2-quinolin-4-ylpropyl acetate?
2-quinolin-4-ylpropyl acetate has a molecular weight of 229.28 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-4-ylpropyl acetate is sourced from PubChem (CID 100926213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).