C16H21N — CID 100926220
(2S,3R)-2-ethynyl-3-propan-2-yl-1-(2,4,6-trimethylphenyl)aziridine (PubChem CID 100926220) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (2S,3R)-2-ethynyl-3-propan-2-yl-1-(2,4,6-trimethylphenyl)aziridine.
| Compound Name | (2S,3R)-2-ethynyl-3-propan-2-yl-1-(2,4,6-trimethylphenyl)aziridine |
|---|---|
| PubChem CID | 100926220 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (2S,3R)-2-ethynyl-3-propan-2-yl-1-(2,4,6-trimethylphenyl)aziridine |
| SMILES | C#C[C@H]1[C@@H](C(C)C)N1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H21N/c1-7-14-15(10(2)3)17(14)16-12(5)8-11(4)9-13(16)6/h1,8-10,14-15H,2-6H3/t14-,15+,17?/m0/s1 |
| InChIKey | IQHCSEYTISSHEI-BTPDTDQASA-N |
| XLogP | 3.46 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|