About 4-ethylsulfinyl-N,N-dimethylaniline
4-ethylsulfinyl-N,N-dimethylaniline (PubChem CID 100926411) has the molecular formula C10H15NOS
and a molecular weight of 197.30 g/mol. Its IUPAC name is 4-ethylsulfinyl-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-ethylsulfinyl-N,N-dimethylaniline |
| PubChem CID | 100926411 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 4-ethylsulfinyl-N,N-dimethylaniline |
| SMILES | CCS(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C10H15NOS/c1-4-13(12)10-7-5-9(6-8-10)11(2)3/h5-8H,4H2,1-3H3 |
| InChIKey | IIYQZPYTVCZOSH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylsulfinyl-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfinyl-N,N-dimethylaniline?
The IUPAC name of 4-ethylsulfinyl-N,N-dimethylaniline (CID 100926411) is 4-ethylsulfinyl-N,N-dimethylaniline.
What is the SMILES notation for 4-ethylsulfinyl-N,N-dimethylaniline?
The canonical SMILES for 4-ethylsulfinyl-N,N-dimethylaniline is CCS(=O)c1ccc(N(C)C)cc1.
What is the InChIKey of 4-ethylsulfinyl-N,N-dimethylaniline?
The InChIKey is IIYQZPYTVCZOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS/c1-4-13(12)10-7-5-9(6-8-10)11(2)3/h5-8H,4H2,1-3H3.
What are the key properties of 4-ethylsulfinyl-N,N-dimethylaniline?
4-ethylsulfinyl-N,N-dimethylaniline has a molecular weight of 197.30 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfinyl-N,N-dimethylaniline is sourced from PubChem (CID 100926411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).