C15H22O4 — CID 100926774
(3aS,7aS)-6-(2-methoxyethyl)spiro[5,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one (PubChem CID 100926774) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (3aS,7aS)-6-(2-methoxyethyl)spiro[5,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one.
| Compound Name | (3aS,7aS)-6-(2-methoxyethyl)spiro[5,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 100926774 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3aS,7aS)-6-(2-methoxyethyl)spiro[5,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4-one |
| SMILES | COCCC1=C[C@@H]2OC3(CCCCC3)O[C@@H]2C(=O)C1 |
| InChI | InChI=1S/C15H22O4/c1-17-8-5-11-9-12(16)14-13(10-11)18-15(19-14)6-3-2-4-7-15/h10,13-14H,2-9H2,1H3/t13-,14+/m0/s1 |
| InChIKey | BOMZNDNSXWPRHJ-UONOGXRCSA-N |
| XLogP | 2.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|