C20H24N2O2 — CID 100927176
(1S,9R,12R,13S,15S,20R)-12-ethyl-8-methyl-14-oxa-8,17-diazahexacyclo[10.7.1.01,9.02,7.013,15.017,20]icosa-2,4,6-trien-16-one (PubChem CID 100927176) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1S,9R,12R,13S,15S,20R)-12-ethyl-8-methyl-14-oxa-8,17-diazahexacyclo[10.7.1.01,9.02,7.013,15.017,20]icosa-2,4,6-trien-16-one.
| Compound Name | (1S,9R,12R,13S,15S,20R)-12-ethyl-8-methyl-14-oxa-8,17-diazahexacyclo[10.7.1.01,9.02,7.013,15.017,20]icosa-2,4,6-trien-16-one |
|---|---|
| PubChem CID | 100927176 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1S,9R,12R,13S,15S,20R)-12-ethyl-8-methyl-14-oxa-8,17-diazahexacyclo[10.7.1.01,9.02,7.013,15.017,20]icosa-2,4,6-trien-16-one |
| SMILES | CC[C@]12CC[C@H]3N(C)c4ccccc4[C@@]34CCN(C(=O)[C@H]3O[C@H]31)[C@@H]24 |
| InChI | InChI=1S/C20H24N2O2/c1-3-19-9-8-14-20(12-6-4-5-7-13(12)21(14)2)10-11-22(18(19)20)17(23)15-16(19)24-15/h4-7,14-16,18H,3,8-11H2,1-2H3/t14-,15+,16-,18+,19+,20+/m1/s1 |
| InChIKey | XBEXJLDOQUEDLH-CNTMNXNISA-N |
| XLogP | 2.31 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|