C27H41NO9 — CID 100927512
8-[2-[[13-(butoxymethyl)-1,3,5,8,11,15-hexaoxacycloheptadec-13-yl]oxy]ethoxy]quinoline (PubChem CID 100927512) has the molecular formula C27H41NO9 and a molecular weight of 523.62 g/mol. Its IUPAC name is 8-[2-[[13-(butoxymethyl)-1,3,5,8,11,15-hexaoxacycloheptadec-13-yl]oxy]ethoxy]quinoline.
| Compound Name | 8-[2-[[13-(butoxymethyl)-1,3,5,8,11,15-hexaoxacycloheptadec-13-yl]oxy]ethoxy]quinoline |
|---|---|
| PubChem CID | 100927512 |
| Molecular Formula | C27H41NO9 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 8-[2-[[13-(butoxymethyl)-1,3,5,8,11,15-hexaoxacycloheptadec-13-yl]oxy]ethoxy]quinoline |
| SMILES | CCCCOCC1(OCCOc2cccc3cccnc23)COCCOCCOCOCOCCOC1 |
| InChI | InChI=1S/C27H41NO9/c1-2-3-10-30-19-27(37-18-17-36-25-8-4-6-24-7-5-9-28-26(24)25)20-31-13-11-29-12-15-33-22-35-23-34-16-14-32-21-27/h4-9H,2-3,10-23H2,1H3 |
| InChIKey | GHIUPTCJBMCDBN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|