C26H33N3O7 — CID 100927522
(2S,3S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-3-amino-1-carboxy-3-oxopropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]-3-methylpentanoic acid (PubChem CID 100927522) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is (2S,3S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-3-amino-1-carboxy-3-oxopropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-3-amino-1-carboxy-3-oxopropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 100927522 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | (2S,3S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S)-3-amino-1-carboxy-3-oxopropyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)N[C@@H](CC(N)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H33N3O7/c1-3-19(2)24(26(35)36)29-23(32)17-15-13-11-9-7-5-4-6-8-10-12-14-16-22(31)28-20(25(33)34)18-21(27)30/h4-17,19-20,24H,3,18H2,1-2H3,(H2,27,30)(H,28,31)(H,29,32)(H,33,34)(H,35,36)/b5-4+,8-6+,9-7+,12-10+,13-11+,16-14+,17-15+/t19-,20-,24-/m0/s1 |
| InChIKey | WMLBQOCWBZNSJH-GHHGTSARSA-N |
| XLogP | 1.94 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|