C27H34N2O8 — CID 100927526
(2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]pentanedioic acid (PubChem CID 100927526) has the molecular formula C27H34N2O8 and a molecular weight of 514.58 g/mol. Its IUPAC name is (2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 100927526 |
| Molecular Formula | C27H34N2O8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | (2S)-2-[[(2E,4E,6E,8E,10E,12E,14E)-16-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-16-oxohexadeca-2,4,6,8,10,12,14-heptaenoyl]amino]pentanedioic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H34N2O8/c1-3-20(2)25(27(36)37)29-23(31)17-15-13-11-9-7-5-4-6-8-10-12-14-16-22(30)28-21(26(34)35)18-19-24(32)33/h4-17,20-21,25H,3,18-19H2,1-2H3,(H,28,30)(H,29,31)(H,32,33)(H,34,35)(H,36,37)/b5-4+,8-6+,9-7+,12-10+,13-11+,16-14+,17-15+/t20-,21-,25-/m0/s1 |
| InChIKey | AHLSXWWYLQGXPJ-VHOBQHEYSA-N |
| XLogP | 2.93 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|