C36H30O3 — CID 100927529
ethyl (3E)-3-ethylidene-7-oxo-1,4,5,6-tetraphenylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 100927529) has the molecular formula C36H30O3 and a molecular weight of 510.63 g/mol. Its IUPAC name is ethyl (3E)-3-ethylidene-7-oxo-1,4,5,6-tetraphenylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (3E)-3-ethylidene-7-oxo-1,4,5,6-tetraphenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 100927529 |
| Molecular Formula | C36H30O3 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | ethyl (3E)-3-ethylidene-7-oxo-1,4,5,6-tetraphenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C/C=C1\C(C(=O)OCC)C2(c3ccccc3)C(=O)C1(c1ccccc1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C36H30O3/c1-3-29-32(33(37)39-4-2)36(28-23-15-8-16-24-28)31(26-19-11-6-12-20-26)30(25-17-9-5-10-18-25)35(29,34(36)38)27-21-13-7-14-22-27/h3,5-24,32H,4H2,1-2H3/b29-3+ |
| InChIKey | JNRDGZWMVSHMBY-KHEHHPRCSA-N |
| XLogP | 7.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|