C37H32O3 — CID 100927530
ethyl (3E)-7-oxo-1,4,5,6-tetraphenyl-3-propylidenebicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 100927530) has the molecular formula C37H32O3 and a molecular weight of 524.66 g/mol. Its IUPAC name is ethyl (3E)-7-oxo-1,4,5,6-tetraphenyl-3-propylidenebicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (3E)-7-oxo-1,4,5,6-tetraphenyl-3-propylidenebicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 100927530 |
| Molecular Formula | C37H32O3 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | ethyl (3E)-7-oxo-1,4,5,6-tetraphenyl-3-propylidenebicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC/C=C1\C(C(=O)OCC)C2(c3ccccc3)C(=O)C1(c1ccccc1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C37H32O3/c1-3-17-30-33(34(38)40-4-2)37(29-24-15-8-16-25-29)32(27-20-11-6-12-21-27)31(26-18-9-5-10-19-26)36(30,35(37)39)28-22-13-7-14-23-28/h5-25,33H,3-4H2,1-2H3/b30-17+ |
| InChIKey | NQBQVHITDHEBNV-OCSSWDANSA-N |
| XLogP | 7.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|