About but-3-yn-2-yl prop-2-enyl carbonate
but-3-yn-2-yl prop-2-enyl carbonate (PubChem CID 100927907) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is but-3-yn-2-yl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | but-3-yn-2-yl prop-2-enyl carbonate |
| PubChem CID | 100927907 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | but-3-yn-2-yl prop-2-enyl carbonate |
| SMILES | C#CC(C)OC(=O)OCC=C |
| InChI | InChI=1S/C8H10O3/c1-4-6-10-8(9)11-7(3)5-2/h2,4,7H,1,6H2,3H3 |
| InChIKey | LFEMNFRVRMCIPO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-yn-2-yl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-yn-2-yl prop-2-enyl carbonate?
The IUPAC name of but-3-yn-2-yl prop-2-enyl carbonate (CID 100927907) is but-3-yn-2-yl prop-2-enyl carbonate.
What is the SMILES notation for but-3-yn-2-yl prop-2-enyl carbonate?
The canonical SMILES for but-3-yn-2-yl prop-2-enyl carbonate is C#CC(C)OC(=O)OCC=C.
What is the InChIKey of but-3-yn-2-yl prop-2-enyl carbonate?
The InChIKey is LFEMNFRVRMCIPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-4-6-10-8(9)11-7(3)5-2/h2,4,7H,1,6H2,3H3.
What are the key properties of but-3-yn-2-yl prop-2-enyl carbonate?
but-3-yn-2-yl prop-2-enyl carbonate has a molecular weight of 154.16 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-yn-2-yl prop-2-enyl carbonate is sourced from PubChem (CID 100927907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).