About O-(4-methylphenyl) furan-2-carbothioate
O-(4-methylphenyl) furan-2-carbothioate (PubChem CID 100928361) has the molecular formula C12H10O2S
and a molecular weight of 218.28 g/mol. Its IUPAC name is O-(4-methylphenyl) furan-2-carbothioate.
Molecular Properties
| Compound Name | O-(4-methylphenyl) furan-2-carbothioate |
| PubChem CID | 100928361 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | O-(4-methylphenyl) furan-2-carbothioate |
| SMILES | Cc1ccc(OC(=S)c2ccco2)cc1 |
| InChI | InChI=1S/C12H10O2S/c1-9-4-6-10(7-5-9)14-12(15)11-3-2-8-13-11/h2-8H,1H3 |
| InChIKey | VCBLZERFSSFCPJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(4-methylphenyl) furan-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(4-methylphenyl) furan-2-carbothioate?
The IUPAC name of O-(4-methylphenyl) furan-2-carbothioate (CID 100928361) is O-(4-methylphenyl) furan-2-carbothioate.
What is the SMILES notation for O-(4-methylphenyl) furan-2-carbothioate?
The canonical SMILES for O-(4-methylphenyl) furan-2-carbothioate is Cc1ccc(OC(=S)c2ccco2)cc1.
What is the InChIKey of O-(4-methylphenyl) furan-2-carbothioate?
The InChIKey is VCBLZERFSSFCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S/c1-9-4-6-10(7-5-9)14-12(15)11-3-2-8-13-11/h2-8H,1H3.
What are the key properties of O-(4-methylphenyl) furan-2-carbothioate?
O-(4-methylphenyl) furan-2-carbothioate has a molecular weight of 218.28 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(4-methylphenyl) furan-2-carbothioate is sourced from PubChem (CID 100928361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).