C14H20O3 — CID 100929161
(1S,3S,4S,7S)-7-ethoxy-3-hydroxy-5-methyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 100929161) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S,3S,4S,7S)-7-ethoxy-3-hydroxy-5-methyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,3S,4S,7S)-7-ethoxy-3-hydroxy-5-methyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 100929161 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S,3S,4S,7S)-7-ethoxy-3-hydroxy-5-methyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C=CC[C@@]1(O)C(=O)[C@H]2C=C(C)[C@@H]1C[C@@H]2OCC |
| InChI | InChI=1S/C14H20O3/c1-4-6-14(16)11-8-12(17-5-2)10(13(14)15)7-9(11)3/h4,7,10-12,16H,1,5-6,8H2,2-3H3/t10-,11-,12-,14-/m0/s1 |
| InChIKey | LXBHLUXTAKIWRY-MNXVOIDGSA-N |
| XLogP | 1.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|