C16H24O6 — CID 100929230
3-O,3-O-diethyl 1-O-methyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate (PubChem CID 100929230) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-O,3-O-diethyl 1-O-methyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate.
| Compound Name | 3-O,3-O-diethyl 1-O-methyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate |
|---|---|
| PubChem CID | 100929230 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-O,3-O-diethyl 1-O-methyl 6-methylhepta-1,6-diene-1,3,3-tricarboxylate |
| SMILES | C=C(C)CC(CC(=C)C(=O)OC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H24O6/c1-7-21-14(18)16(9-11(3)4,15(19)22-8-2)10-12(5)13(17)20-6/h3,5,7-10H2,1-2,4,6H3 |
| InChIKey | LYHDOQXCZGBXPZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|