C14H22O4 — CID 100929372
6-(1,2-dihydroxypropan-2-yl)-3-hydroxy-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (PubChem CID 100929372) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 6-(1,2-dihydroxypropan-2-yl)-3-hydroxy-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
| Compound Name | 6-(1,2-dihydroxypropan-2-yl)-3-hydroxy-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 100929372 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-(1,2-dihydroxypropan-2-yl)-3-hydroxy-4-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
| SMILES | CC1C(O)C(=O)C=C2CCC(C(C)(O)CO)CC21 |
| InChI | InChI=1S/C14H22O4/c1-8-11-6-10(14(2,18)7-15)4-3-9(11)5-12(16)13(8)17/h5,8,10-11,13,15,17-18H,3-4,6-7H2,1-2H3 |
| InChIKey | YARSTGAEKZQRNL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |