C11H18 — CID 100929671
(1R)-1-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene (PubChem CID 100929671) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (1R)-1-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene.
| Compound Name | (1R)-1-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
|---|---|
| PubChem CID | 100929671 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1R)-1-methyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| SMILES | C[C@@H]1CCCC2CCCC=C21 |
| InChI | InChI=1S/C11H18/c1-9-5-4-7-10-6-2-3-8-11(9)10/h8-10H,2-7H2,1H3/t9-,10?/m1/s1 |
| InChIKey | RWVLUKBXMQLXQF-YHMJZVADSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|