C14H16O5 — CID 100929819
(3aS,5S,9bS)-6,9-dimethoxy-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one (PubChem CID 100929819) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3aS,5S,9bS)-6,9-dimethoxy-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one.
| Compound Name | (3aS,5S,9bS)-6,9-dimethoxy-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one |
|---|---|
| PubChem CID | 100929819 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (3aS,5S,9bS)-6,9-dimethoxy-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromen-2-one |
| SMILES | COc1ccc(OC)c2c1[C@H](C)O[C@H]1CC(=O)O[C@@H]21 |
| InChI | InChI=1S/C14H16O5/c1-7-12-8(16-2)4-5-9(17-3)13(12)14-10(18-7)6-11(15)19-14/h4-5,7,10,14H,6H2,1-3H3/t7-,10-,14+/m0/s1 |
| InChIKey | UCFAWOSGIBIEKP-MRCLBUSBSA-N |
| XLogP | 2.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |