C57H99N9+6 — CID 100930355
[3-(azaniumylmethyl)-5-[[3,5-bis[[3,5-bis(azaniumylmethyl)-2,4,6-triethylanilino]methyl]-2,4,6-triethylphenyl]methylamino]-2,4,6-triethylphenyl]methylazanium (PubChem CID 100930355) has the molecular formula C57H99N9+6 and a molecular weight of 910.48 g/mol. Its IUPAC name is [3-(azaniumylmethyl)-5-[[3,5-bis[[3,5-bis(azaniumylmethyl)-2,4,6-triethylanilino]methyl]-2,4,6-triethylphenyl]methylamino]-2,4,6-triethylphenyl]methylazanium.
| Compound Name | [3-(azaniumylmethyl)-5-[[3,5-bis[[3,5-bis(azaniumylmethyl)-2,4,6-triethylanilino]methyl]-2,4,6-triethylphenyl]methylamino]-2,4,6-triethylphenyl]methylazanium |
|---|---|
| PubChem CID | 100930355 |
| Molecular Formula | C57H99N9+6 |
| Molecular Weight | 910.48 g/mol |
| Exact Mass | 909.80 |
| IUPAC Name | [3-(azaniumylmethyl)-5-[[3,5-bis[[3,5-bis(azaniumylmethyl)-2,4,6-triethylanilino]methyl]-2,4,6-triethylphenyl]methylamino]-2,4,6-triethylphenyl]methylazanium |
| SMILES | CCc1c(CNc2c(CC)c(C[NH3+])c(CC)c(C[NH3+])c2CC)c(CC)c(CNc2c(CC)c(C[NH3+])c(CC)c(C[NH3+])c2CC)c(CC)c1CNc1c(CC)c(C[NH3+])c(CC)c(C[NH3+])c1CC |
| InChI | InChI=1S/C57H93N9/c1-13-34-46(25-58)40(19-7)55(41(20-8)47(34)26-59)64-31-52-37(16-4)53(32-65-56-42(21-9)48(27-60)35(14-2)49(28-61)43(56)22-10)39(18-6)54(38(52)17-5)33-66-57-44(23-11)50(29-62)36(15-3)51(30-63)45(57)24-12/h64-66H,13-33,58-63H2,1-12H3/p+6 |
| InChIKey | QQRRQKNXYHBHPD-UHFFFAOYSA-T |
| XLogP | 5.72 |
| TPSA | 201.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 3 |