C26H21NO2S — CID 10093056
6-(4-methylphenyl)-2,4-diphenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-5,7-dione (PubChem CID 10093056) has the molecular formula C26H21NO2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 6-(4-methylphenyl)-2,4-diphenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-5,7-dione.
| Compound Name | 6-(4-methylphenyl)-2,4-diphenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-5,7-dione |
|---|---|
| PubChem CID | 10093056 |
| Molecular Formula | C26H21NO2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 6-(4-methylphenyl)-2,4-diphenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-5,7-dione |
| SMILES | Cc1ccc(N2C(=O)C3SC(c4ccccc4)=CC(c4ccccc4)C3C2=O)cc1 |
| InChI | InChI=1S/C26H21NO2S/c1-17-12-14-20(15-13-17)27-25(28)23-21(18-8-4-2-5-9-18)16-22(30-24(23)26(27)29)19-10-6-3-7-11-19/h2-16,21,23-24H,1H3 |
| InChIKey | YXOVCEYHWAIGDB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|