About 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol
4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol (PubChem CID 100930652) has the molecular formula C20H34O2Si2
and a molecular weight of 362.66 g/mol. Its IUPAC name is 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol.
Molecular Properties
| Compound Name | 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol |
| PubChem CID | 100930652 |
| Molecular Formula | C20H34O2Si2 |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol |
| SMILES | C=CCC(O)(CC=C)C(O)(CC#C[Si](C)(C)C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C20H34O2Si2/c1-9-13-19(21,14-10-2)20(22,15-11-17-23(3,4)5)16-12-18-24(6,7)8/h9-10,21-22H,1-2,13-16H2,3-8H3 |
| InChIKey | NREIUQBKDSNLHY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol?
The IUPAC name of 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol (CID 100930652) is 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol.
What is the SMILES notation for 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol?
The canonical SMILES for 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol is C=CCC(O)(CC=C)C(O)(CC#C[Si](C)(C)C)CC#C[Si](C)(C)C.
What is the InChIKey of 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol?
The InChIKey is NREIUQBKDSNLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2Si2/c1-9-13-19(21,14-10-2)20(22,15-11-17-23(3,4)5)16-12-18-24(6,7)8/h9-10,21-22H,1-2,13-16H2,3-8H3.
What are the key properties of 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol?
4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol has a molecular weight of 362.66 g/mol, XLogP of 4.14, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-8-trimethylsilyl-5-(3-trimethylsilylprop-2-ynyl)oct-1-en-7-yne-4,5-diol is sourced from PubChem (CID 100930652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).