About bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate
bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate (PubChem CID 100930737) has the molecular formula C49H44O8
and a molecular weight of 760.88 g/mol. Its IUPAC name is bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate.
Molecular Properties
| Compound Name | bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate |
| PubChem CID | 100930737 |
| Molecular Formula | C49H44O8 |
| Molecular Weight | 760.88 g/mol |
| Exact Mass | 760.30 |
| IUPAC Name | bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate |
| SMILES | O=C(CCCCCCCCCC(=O)Oc1ccc(C(=O)Oc2ccc(-c3ccccc3)cc2)cc1)Oc1ccc(C(=O)Oc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C49H44O8/c50-46(54-42-32-24-40(25-33-42)48(52)56-44-28-20-38(21-29-44)36-14-8-6-9-15-36)18-12-4-2-1-3-5-13-19-47(51)55-43-34-26-41(27-35-43)49(53)57-45-30-22-39(23-31-45)37-16-10-7-11-17-37/h6-11,14-17,20-35H,1-5,12-13,18-19H2 |
| InChIKey | MJJKNAXLSSSGPG-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 760.88 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate?
The IUPAC name of bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate (CID 100930737) is bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate.
What is the SMILES notation for bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate?
The canonical SMILES for bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate is O=C(CCCCCCCCCC(=O)Oc1ccc(C(=O)Oc2ccc(-c3ccccc3)cc2)cc1)Oc1ccc(C(=O)Oc2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate?
The InChIKey is MJJKNAXLSSSGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H44O8/c50-46(54-42-32-24-40(25-33-42)48(52)56-44-28-20-38(21-29-44)36-14-8-6-9-15-36)18-12-4-2-1-3-5-13-19-47(51)55-43-34-26-41(27-35-43)49(53)57-45-30-22-39(23-31-45)37-16-10-7-11-17-37/h6-11,14-17,20-35H,1-5,12-13,18-19H2.
What are the key properties of bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate?
bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate has a molecular weight of 760.88 g/mol, XLogP of 11.48, 18 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(4-phenylphenoxy)carbonylphenyl] undecanedioate is sourced from PubChem (CID 100930737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).