C11H9F9OS — CID 100930748
4,4,5,5,6,6,7,7,7-nonafluoro-1-thiophen-3-ylheptan-1-ol (PubChem CID 100930748) has the molecular formula C11H9F9OS and a molecular weight of 360.24 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoro-1-thiophen-3-ylheptan-1-ol.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoro-1-thiophen-3-ylheptan-1-ol |
|---|---|
| PubChem CID | 100930748 |
| Molecular Formula | C11H9F9OS |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoro-1-thiophen-3-ylheptan-1-ol |
| SMILES | OC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccsc1 |
| InChI | InChI=1S/C11H9F9OS/c12-8(13,3-1-7(21)6-2-4-22-5-6)9(14,15)10(16,17)11(18,19)20/h2,4-5,7,21H,1,3H2 |
| InChIKey | LGHIHXCJPCJFKE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|