C19H19F3N2O3S — CID 10093085
(5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-16-yl) trifluoromethanesulfonate (PubChem CID 10093085) has the molecular formula C19H19F3N2O3S and a molecular weight of 412.43 g/mol. Its IUPAC name is (5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-16-yl) trifluoromethanesulfonate.
| Compound Name | (5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-16-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10093085 |
| Molecular Formula | C19H19F3N2O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-16-yl) trifluoromethanesulfonate |
| SMILES | CN1CCN2c3cccc(OS(=O)(=O)C(F)(F)F)c3Cc3ccccc3C2C1 |
| InChI | InChI=1S/C19H19F3N2O3S/c1-23-9-10-24-16-7-4-8-18(27-28(25,26)19(20,21)22)15(16)11-13-5-2-3-6-14(13)17(24)12-23/h2-8,17H,9-12H2,1H3 |
| InChIKey | BGDYWOAZVWLZSA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|