C14H21F3O8S — CID 100930873
[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2,2,2-trifluoroethanesulfonate (PubChem CID 100930873) has the molecular formula C14H21F3O8S and a molecular weight of 406.38 g/mol. Its IUPAC name is [(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2,2,2-trifluoroethanesulfonate.
| Compound Name | [(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 100930873 |
| Molecular Formula | C14H21F3O8S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl 2,2,2-trifluoroethanesulfonate |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COS(=O)(=O)CC(F)(F)F)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H21F3O8S/c1-12(2)22-8-7(5-20-26(18,19)6-14(15,16)17)21-11-10(9(8)23-12)24-13(3,4)25-11/h7-11H,5-6H2,1-4H3/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | ZLCLQEHVONFQGS-ZKKRXERASA-N |
| XLogP | 1.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|