C45H75NO6 — CID 100931445
[(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] pyridine-3-carboxylate (PubChem CID 100931445) has the molecular formula C45H75NO6 and a molecular weight of 726.10 g/mol. Its IUPAC name is [(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] pyridine-3-carboxylate.
| Compound Name | [(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 100931445 |
| Molecular Formula | C45H75NO6 |
| Molecular Weight | 726.10 g/mol |
| Exact Mass | 725.56 |
| IUPAC Name | [(2S)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] pyridine-3-carboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](COC(=O)c1cccnc1)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C45H75NO6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-43(47)50-39-42(40-51-45(49)41-34-33-37-46-38-41)52-44(48)36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,33-34,37-38,42H,3-16,21-32,35-36,39-40H2,1-2H3/b19-17-,20-18-/t42-/m0/s1 |
| InChIKey | MUWHWBXKCJRLQK-XZIBJWJKSA-N |
| XLogP | 12.77 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.10 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|