C8H6N2O2 — CID 100931778
(1S,2S,6R)-1,4-dinitrosotricyclo[4.2.0.02,5]octa-3,7-diene (PubChem CID 100931778) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is (1S,2S,6R)-1,4-dinitrosotricyclo[4.2.0.02,5]octa-3,7-diene.
| Compound Name | (1S,2S,6R)-1,4-dinitrosotricyclo[4.2.0.02,5]octa-3,7-diene |
|---|---|
| PubChem CID | 100931778 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | (1S,2S,6R)-1,4-dinitrosotricyclo[4.2.0.02,5]octa-3,7-diene |
| SMILES | O=NC1=C[C@H]2C1[C@H]1C=C[C@]12N=O |
| InChI | InChI=1S/C8H6N2O2/c11-9-6-3-5-7(6)4-1-2-8(4,5)10-12/h1-5,7H/t4-,5+,7?,8+/m1/s1 |
| InChIKey | KHUCJGOOOBXZMB-WMDNSZJCSA-N |
| XLogP | 1.59 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|