C28H46O6P2Si2 — CID 100932103
4,4,8,8-tetratert-butyl-2,6-dioxido-2,6-diphenyl-1,3,5,7,2,6,4,8-tetraoxadiphosphadisilocane-2,6-diium (PubChem CID 100932103) has the molecular formula C28H46O6P2Si2 and a molecular weight of 596.79 g/mol. Its IUPAC name is 4,4,8,8-tetratert-butyl-2,6-dioxido-2,6-diphenyl-1,3,5,7,2,6,4,8-tetraoxadiphosphadisilocane-2,6-diium.
| Compound Name | 4,4,8,8-tetratert-butyl-2,6-dioxido-2,6-diphenyl-1,3,5,7,2,6,4,8-tetraoxadiphosphadisilocane-2,6-diium |
|---|---|
| PubChem CID | 100932103 |
| Molecular Formula | C28H46O6P2Si2 |
| Molecular Weight | 596.79 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 4,4,8,8-tetratert-butyl-2,6-dioxido-2,6-diphenyl-1,3,5,7,2,6,4,8-tetraoxadiphosphadisilocane-2,6-diium |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)O[P+]([O-])(c2ccccc2)O[Si](C(C)(C)C)(C(C)(C)C)O[P+]([O-])(c2ccccc2)O1 |
| InChI | InChI=1S/C28H46O6P2Si2/c1-25(2,3)37(26(4,5)6)31-35(29,23-19-15-13-16-20-23)33-38(27(7,8)9,28(10,11)12)34-36(30,32-37)24-21-17-14-18-22-24/h13-22H,1-12H3 |
| InChIKey | FZKLYDWKHSLKRB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.79 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|