C23H30N2O5 — CID 10093227
2-[1-(3,4-dimethoxyphenyl)ethylideneamino]-N,N-diethyl-4,5-dimethoxybenzamide (PubChem CID 10093227) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)ethylideneamino]-N,N-diethyl-4,5-dimethoxybenzamide.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)ethylideneamino]-N,N-diethyl-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 10093227 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)ethylideneamino]-N,N-diethyl-4,5-dimethoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(OC)c(OC)cc1/N=C(\C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H30N2O5/c1-8-25(9-2)23(26)17-13-21(29-6)22(30-7)14-18(17)24-15(3)16-10-11-19(27-4)20(12-16)28-5/h10-14H,8-9H2,1-7H3/b24-15+ |
| InChIKey | HQRUSPMQCIZLGN-BUVRLJJBSA-N |
| XLogP | 4.34 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|