C12H23GeNO3 — CID 100933127
(3S,7S)-3,7,10-trimethyl-1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane (PubChem CID 100933127) has the molecular formula C12H23GeNO3 and a molecular weight of 301.93 g/mol. Its IUPAC name is (3S,7S)-3,7,10-trimethyl-1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane.
| Compound Name | (3S,7S)-3,7,10-trimethyl-1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 100933127 |
| Molecular Formula | C12H23GeNO3 |
| Molecular Weight | 301.93 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (3S,7S)-3,7,10-trimethyl-1-prop-2-enyl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane |
| SMILES | C=CC[Ge]12OC(C)CN(C[C@H](C)O1)C[C@H](C)O2 |
| InChI | InChI=1S/C12H23GeNO3/c1-5-6-13-15-10(2)7-14(8-11(3)16-13)9-12(4)17-13/h5,10-12H,1,6-9H2,2-4H3/t10-,11-,12?/m0/s1 |
| InChIKey | GLRLSBXBVNNRRH-NDQFZYFBSA-N |
| XLogP | 1.66 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.93 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|