About (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile
(2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile (PubChem CID 100934067) has the molecular formula C17H18N2
and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile |
| PubChem CID | 100934067 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile |
| SMILES | CC[C@@H]1CC(C)=C[C@@H](c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C17H18N2/c1-3-15-9-13(2)10-16(17(15,11-18)12-19)14-7-5-4-6-8-14/h4-8,10,15-16H,3,9H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | XYXQUROYMWTVAQ-CVEARBPZSA-N |
| XLogP | 4.18 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile?
The IUPAC name of (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile (CID 100934067) is (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile.
What is the SMILES notation for (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile?
The canonical SMILES for (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile is CC[C@@H]1CC(C)=C[C@@H](c2ccccc2)C1(C#N)C#N.
What is the InChIKey of (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile?
The InChIKey is XYXQUROYMWTVAQ-CVEARBPZSA-N. The full InChI is InChI=1S/C17H18N2/c1-3-15-9-13(2)10-16(17(15,11-18)12-19)14-7-5-4-6-8-14/h4-8,10,15-16H,3,9H2,1-2H3/t15-,16+/m1/s1.
What are the key properties of (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile?
(2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile has a molecular weight of 250.34 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-6-ethyl-4-methyl-2-phenylcyclohex-3-ene-1,1-dicarbonitrile is sourced from PubChem (CID 100934067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).