About 5-(2-aminoethyl)pyrimidine-2,4,6-triamine
5-(2-aminoethyl)pyrimidine-2,4,6-triamine (PubChem CID 100934550) has the molecular formula C6H12N6
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-(2-aminoethyl)pyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)pyrimidine-2,4,6-triamine |
| PubChem CID | 100934550 |
| Molecular Formula | C6H12N6 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 5-(2-aminoethyl)pyrimidine-2,4,6-triamine |
| SMILES | NCCc1c(N)nc(N)nc1N |
| InChI | InChI=1S/C6H12N6/c7-2-1-3-4(8)11-6(10)12-5(3)9/h1-2,7H2,(H6,8,9,10,11,12) |
| InChIKey | NKQRTZJFHHYFBO-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(2-aminoethyl)pyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)pyrimidine-2,4,6-triamine?
The IUPAC name of 5-(2-aminoethyl)pyrimidine-2,4,6-triamine (CID 100934550) is 5-(2-aminoethyl)pyrimidine-2,4,6-triamine.
What is the SMILES notation for 5-(2-aminoethyl)pyrimidine-2,4,6-triamine?
The canonical SMILES for 5-(2-aminoethyl)pyrimidine-2,4,6-triamine is NCCc1c(N)nc(N)nc1N.
What is the InChIKey of 5-(2-aminoethyl)pyrimidine-2,4,6-triamine?
The InChIKey is NKQRTZJFHHYFBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N6/c7-2-1-3-4(8)11-6(10)12-5(3)9/h1-2,7H2,(H6,8,9,10,11,12).
What are the key properties of 5-(2-aminoethyl)pyrimidine-2,4,6-triamine?
5-(2-aminoethyl)pyrimidine-2,4,6-triamine has a molecular weight of 168.20 g/mol, XLogP of -1.28, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)pyrimidine-2,4,6-triamine is sourced from PubChem (CID 100934550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).