C19H23NO7 — CID 100934636
trimethyl 6-oxo-14-azabicyclo[8.3.1]tetradeca-1(13),10(14),11-triene-3,3,8-tricarboxylate (PubChem CID 100934636) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is trimethyl 6-oxo-14-azabicyclo[8.3.1]tetradeca-1(13),10(14),11-triene-3,3,8-tricarboxylate.
| Compound Name | trimethyl 6-oxo-14-azabicyclo[8.3.1]tetradeca-1(13),10(14),11-triene-3,3,8-tricarboxylate |
|---|---|
| PubChem CID | 100934636 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | trimethyl 6-oxo-14-azabicyclo[8.3.1]tetradeca-1(13),10(14),11-triene-3,3,8-tricarboxylate |
| SMILES | COC(=O)C1CC(=O)CCC(C(=O)OC)(C(=O)OC)Cc2cccc(n2)C1 |
| InChI | InChI=1S/C19H23NO7/c1-25-16(22)12-9-13-5-4-6-14(20-13)11-19(17(23)26-2,18(24)27-3)8-7-15(21)10-12/h4-6,12H,7-11H2,1-3H3 |
| InChIKey | ULFIAVOBQDMCCI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|