C17H14O4 — CID 100935166
4-[(1R,2R,6S,7S)-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]benzoic acid (PubChem CID 100935166) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[(1R,2R,6S,7S)-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]benzoic acid.
| Compound Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]benzoic acid |
|---|---|
| PubChem CID | 100935166 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-tricyclo[5.2.1.02,6]dec-8-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C17H14O4/c18-15-12-10-5-6-11(7-10)13(12)16(19)14(15)8-1-3-9(4-2-8)17(20)21/h1-6,10-14H,7H2,(H,20,21)/t10-,11+,12+,13-,14? |
| InChIKey | MOPJMVHBMCHPLH-PLADLKKGSA-N |
| XLogP | 2.06 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|