C15H18N2O8S2 — CID 100935549
(2S)-2-amino-3-[4-[(2S)-2-amino-2-carboxyethyl]sulfanyl-5-[(E)-2-carboxyethenyl]-2,3-dihydroxyphenyl]sulfanylpropanoic acid (PubChem CID 100935549) has the molecular formula C15H18N2O8S2 and a molecular weight of 418.45 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[(2S)-2-amino-2-carboxyethyl]sulfanyl-5-[(E)-2-carboxyethenyl]-2,3-dihydroxyphenyl]sulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[(2S)-2-amino-2-carboxyethyl]sulfanyl-5-[(E)-2-carboxyethenyl]-2,3-dihydroxyphenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 100935549 |
| Molecular Formula | C15H18N2O8S2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | (2S)-2-amino-3-[4-[(2S)-2-amino-2-carboxyethyl]sulfanyl-5-[(E)-2-carboxyethenyl]-2,3-dihydroxyphenyl]sulfanylpropanoic acid |
| SMILES | N[C@H](CSc1cc(/C=C/C(=O)O)c(SC[C@@H](N)C(=O)O)c(O)c1O)C(=O)O |
| InChI | InChI=1S/C15H18N2O8S2/c16-7(14(22)23)4-26-9-3-6(1-2-10(18)19)13(12(21)11(9)20)27-5-8(17)15(24)25/h1-3,7-8,20-21H,4-5,16-17H2,(H,18,19)(H,22,23)(H,24,25)/b2-1+/t7-,8-/m1/s1 |
| InChIKey | YORLLTCQOBHLHS-XLNBVVSQSA-N |
| XLogP | 0.20 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|