C14H20O4 — CID 100935655
(2S,3R,4S,5R,6R,10S,11S,12R,13S,14R)-pentacyclo[6.6.0.02,6.03,13.010,14]tetradecane-4,5,11,12-tetrol (PubChem CID 100935655) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R,10S,11S,12R,13S,14R)-pentacyclo[6.6.0.02,6.03,13.010,14]tetradecane-4,5,11,12-tetrol.
| Compound Name | (2S,3R,4S,5R,6R,10S,11S,12R,13S,14R)-pentacyclo[6.6.0.02,6.03,13.010,14]tetradecane-4,5,11,12-tetrol |
|---|---|
| PubChem CID | 100935655 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2S,3R,4S,5R,6R,10S,11S,12R,13S,14R)-pentacyclo[6.6.0.02,6.03,13.010,14]tetradecane-4,5,11,12-tetrol |
| SMILES | O[C@@H]1[C@H](O)[C@H]2[C@@H]3C4C(C[C@H]13)C[C@H]1[C@@H](O)[C@@H](O)[C@@H]2[C@@H]41 |
| InChI | InChI=1S/C14H20O4/c15-11-4-1-3-2-5-8-6(3)7(4)9(13(11)17)10(8)14(18)12(5)16/h3-18H,1-2H2/t3?,4-,5+,6?,7-,8+,9-,10+,11-,12+,13+,14- |
| InChIKey | HBAPLOSXDROCSN-TTZIUQEFSA-N |
| XLogP | -0.79 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |