About 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline
7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline (PubChem CID 10093589) has the molecular formula C26H20N4O2
and a molecular weight of 420.47 g/mol. Its IUPAC name is 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline.
Molecular Properties
| Compound Name | 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline |
| PubChem CID | 10093589 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline |
| SMILES | COc1ccnc(CCc2nc3nc4ccc(-c5cc6ccccc6o5)cc4cc3[nH]2)c1 |
| InChI | InChI=1S/C26H20N4O2/c1-31-20-10-11-27-19(15-20)7-9-25-28-22-13-18-12-17(6-8-21(18)29-26(22)30-25)24-14-16-4-2-3-5-23(16)32-24/h2-6,8,10-15H,7,9H2,1H3,(H,28,29,30) |
| InChIKey | XBUIMXVGLMTFGZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline?
The IUPAC name of 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline (CID 10093589) is 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline.
What is the SMILES notation for 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline?
The canonical SMILES for 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline is COc1ccnc(CCc2nc3nc4ccc(-c5cc6ccccc6o5)cc4cc3[nH]2)c1.
What is the InChIKey of 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline?
The InChIKey is XBUIMXVGLMTFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N4O2/c1-31-20-10-11-27-19(15-20)7-9-25-28-22-13-18-12-17(6-8-21(18)29-26(22)30-25)24-14-16-4-2-3-5-23(16)32-24/h2-6,8,10-15H,7,9H2,1H3,(H,28,29,30).
What are the key properties of 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline?
7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline has a molecular weight of 420.47 g/mol, XLogP of 5.71, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-benzofuran-2-yl)-2-[2-(4-methoxy-2-pyridinyl)ethyl]-1H-imidazo[4,5-b]quinoline is sourced from PubChem (CID 10093589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).