C22H32N2O4S — CID 10093613
N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]decanamide (PubChem CID 10093613) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]decanamide.
| Compound Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]decanamide |
|---|---|
| PubChem CID | 10093613 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCCOc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C22H32N2O4S/c1-2-3-4-5-6-7-8-9-20(25)23-14-15-28-18-12-10-17(11-13-18)16-19-21(26)24-22(27)29-19/h10-13,19H,2-9,14-16H2,1H3,(H,23,25)(H,24,26,27) |
| InChIKey | YIWPDTBPOFQKDA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|