C18H25N3O4 — CID 100936188
diethyl 2-spiro[3,5-dihydro-1H-imidazo[4,5-c]pyridine-2,1'-cyclohexane]-4-ylidenepropanedioate (PubChem CID 100936188) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is diethyl 2-spiro[3,5-dihydro-1H-imidazo[4,5-c]pyridine-2,1'-cyclohexane]-4-ylidenepropanedioate.
| Compound Name | diethyl 2-spiro[3,5-dihydro-1H-imidazo[4,5-c]pyridine-2,1'-cyclohexane]-4-ylidenepropanedioate |
|---|---|
| PubChem CID | 100936188 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | diethyl 2-spiro[3,5-dihydro-1H-imidazo[4,5-c]pyridine-2,1'-cyclohexane]-4-ylidenepropanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1NC=CC2=C1NC1(CCCCC1)N2 |
| InChI | InChI=1S/C18H25N3O4/c1-3-24-16(22)13(17(23)25-4-2)15-14-12(8-11-19-15)20-18(21-14)9-6-5-7-10-18/h8,11,19-21H,3-7,9-10H2,1-2H3 |
| InChIKey | NONASTXODDJLPW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|