C6H7N5 — CID 100936433
N-[(Z)-2-amino-1,2-dicyanoethenyl]-N'-methylmethanimidamide (PubChem CID 100936433) has the molecular formula C6H7N5 and a molecular weight of 149.16 g/mol. Its IUPAC name is N-[(Z)-2-amino-1,2-dicyanoethenyl]-N'-methylmethanimidamide.
| Compound Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 100936433 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | N-[(Z)-2-amino-1,2-dicyanoethenyl]-N'-methylmethanimidamide |
| SMILES | C/N=C/N/C(C#N)=C(\N)C#N |
| InChI | InChI=1S/C6H7N5/c1-10-4-11-6(3-8)5(9)2-7/h4H,9H2,1H3,(H,10,11)/b6-5- |
| InChIKey | NFDLNFOEGVBKIZ-WAYWQWQTSA-N |
| XLogP | -0.55 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|