C16H31IOSi — CID 100936880
tert-butyl-[(5E,9Z)-10-iododeca-5,9-dienoxy]-dimethylsilane (PubChem CID 100936880) has the molecular formula C16H31IOSi and a molecular weight of 394.41 g/mol. Its IUPAC name is tert-butyl-[(5E,9Z)-10-iododeca-5,9-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5E,9Z)-10-iododeca-5,9-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 100936880 |
| Molecular Formula | C16H31IOSi |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | tert-butyl-[(5E,9Z)-10-iododeca-5,9-dienoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC/C=C/CC/C=C\I |
| InChI | InChI=1S/C16H31IOSi/c1-16(2,3)19(4,5)18-15-13-11-9-7-6-8-10-12-14-17/h6-7,12,14H,8-11,13,15H2,1-5H3/b7-6+,14-12- |
| InChIKey | HRQWZDMLDVXAPL-NLHMQVGESA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|