C20H27BO4 — CID 100936935
(4-cyclooctyl-4-methyl-6-phenyl-1,3,2-dioxaborinin-2-yl) acetate (PubChem CID 100936935) has the molecular formula C20H27BO4 and a molecular weight of 342.24 g/mol. Its IUPAC name is (4-cyclooctyl-4-methyl-6-phenyl-1,3,2-dioxaborinin-2-yl) acetate.
| Compound Name | (4-cyclooctyl-4-methyl-6-phenyl-1,3,2-dioxaborinin-2-yl) acetate |
|---|---|
| PubChem CID | 100936935 |
| Molecular Formula | C20H27BO4 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (4-cyclooctyl-4-methyl-6-phenyl-1,3,2-dioxaborinin-2-yl) acetate |
| SMILES | CC(=O)OB1OC(c2ccccc2)=CC(C)(C2CCCCCCC2)O1 |
| InChI | InChI=1S/C20H27BO4/c1-16(22)23-21-24-19(17-11-7-6-8-12-17)15-20(2,25-21)18-13-9-4-3-5-10-14-18/h6-8,11-12,15,18H,3-5,9-10,13-14H2,1-2H3 |
| InChIKey | NACHIQHRPMBVGP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|