About CID 100936953
CID 100936953 (PubChem CID 100936953) has the molecular formula C16H19N2O
and a molecular weight of 255.34 g/mol.
Molecular Properties
| Compound Name | CID 100936953 |
| PubChem CID | 100936953 |
| Molecular Formula | C16H19N2O |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cn(-c3ccccc3)cc2C(C)(C)N1[O] |
| InChI | InChI=1S/C16H19N2O/c1-15(2)13-10-17(12-8-6-5-7-9-12)11-14(13)16(3,4)18(15)19/h5-11H,1-4H3 |
| InChIKey | BRXIFMWXBMSTGC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 100936953 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100936953?
The IUPAC name of CID 100936953 (CID 100936953) is not available.
What is the SMILES notation for CID 100936953?
The canonical SMILES for CID 100936953 is CC1(C)c2cn(-c3ccccc3)cc2C(C)(C)N1[O].
What is the InChIKey of CID 100936953?
The InChIKey is BRXIFMWXBMSTGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N2O/c1-15(2)13-10-17(12-8-6-5-7-9-12)11-14(13)16(3,4)18(15)19/h5-11H,1-4H3.
What are the key properties of CID 100936953?
CID 100936953 has a molecular weight of 255.34 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100936953 is sourced from PubChem (CID 100936953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).